C10H11ClN2O2 — CID 22063849
2-(2-aminoethyl)isoindole-1,3-dione;hydrochloride (PubChem CID 22063849) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 2-(2-aminoethyl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(2-aminoethyl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 22063849 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(2-aminoethyl)isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H10N2O2.ClH/c11-5-6-12-9(13)7-3-1-2-4-8(7)10(12)14;/h1-4H,5-6,11H2;1H |
| InChIKey | UIRMSBGEEQIABR-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|