C26H28N2O8 — CID 12692562
2-[2-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]isoindole-1,3-dione (PubChem CID 12692562) has the molecular formula C26H28N2O8 and a molecular weight of 496.52 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 12692562 |
| Molecular Formula | C26H28N2O8 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCOCCOCCOCCOCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H28N2O8/c29-23-19-5-1-2-6-20(19)24(30)27(23)9-11-33-13-15-35-17-18-36-16-14-34-12-10-28-25(31)21-7-3-4-8-22(21)26(28)32/h1-8H,9-18H2 |
| InChIKey | PRDFLWUHKYWOHD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|