C19H19NO4 — CID 51354396
2-[2-(2-phenylmethoxyethoxy)ethyl]isoindole-1,3-dione (PubChem CID 51354396) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-[2-(2-phenylmethoxyethoxy)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-phenylmethoxyethoxy)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 51354396 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[2-(2-phenylmethoxyethoxy)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCOCCOCc1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c21-18-16-8-4-5-9-17(16)19(22)20(18)10-11-23-12-13-24-14-15-6-2-1-3-7-15/h1-9H,10-14H2 |
| InChIKey | VABDBKFDWJHKQE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|