C12H12INO4 — CID 143275850
2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl hypoiodite (PubChem CID 143275850) has the molecular formula C12H12INO4 and a molecular weight of 361.14 g/mol. Its IUPAC name is 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl hypoiodite.
| Compound Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl hypoiodite |
|---|---|
| PubChem CID | 143275850 |
| Molecular Formula | C12H12INO4 |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethyl hypoiodite |
| SMILES | O=C1c2ccccc2C(=O)N1CCOCCOI |
| InChI | InChI=1S/C12H12INO4/c13-18-8-7-17-6-5-14-11(15)9-3-1-2-4-10(9)12(14)16/h1-4H,5-8H2 |
| InChIKey | PAZYRYKEKFCZEJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|