C24H37NO9 — CID 155179726
2-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]isoindole-1,3-dione (PubChem CID 155179726) has the molecular formula C24H37NO9 and a molecular weight of 483.56 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155179726 |
| Molecular Formula | C24H37NO9 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]isoindole-1,3-dione |
| SMILES | CCOCCOCCOCCOCCOCCOCCOCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H37NO9/c1-2-28-9-10-30-13-14-32-17-18-34-20-19-33-16-15-31-12-11-29-8-7-25-23(26)21-5-3-4-6-22(21)24(25)27/h3-6H,2,7-20H2,1H3 |
| InChIKey | RPVYNEWLRCAURQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|