C17H21NO7 — CID 14462388
3-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 14462388) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is 3-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 14462388 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-[2-[2-[2-(1,3-dioxoisoindol-2-yl)ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCOCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H21NO7/c19-15(20)5-7-23-9-11-25-12-10-24-8-6-18-16(21)13-3-1-2-4-14(13)17(18)22/h1-4H,5-12H2,(H,19,20) |
| InChIKey | XMSDRSYXLUAWFR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|