C14H15MnNO4 — CID 174657326
6-(1,3-dioxoisoindol-2-yl)hexanoic acid;manganese (PubChem CID 174657326) has the molecular formula C14H15MnNO4 and a molecular weight of 316.21 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)hexanoic acid;manganese.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)hexanoic acid;manganese |
|---|---|
| PubChem CID | 174657326 |
| Molecular Formula | C14H15MnNO4 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)hexanoic acid;manganese |
| SMILES | O=C(O)CCCCCN1C(=O)c2ccccc2C1=O.[Mn] |
| InChI | InChI=1S/C14H15NO4.Mn/c16-12(17)8-2-1-5-9-15-13(18)10-6-3-4-7-11(10)14(15)19;/h3-4,6-7H,1-2,5,8-9H2,(H,16,17); |
| InChIKey | CYPXPFUZFZVMBU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|