C28H28N2O3 — CID 91963142
N,N-dibenzyl-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 91963142) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is N,N-dibenzyl-6-(1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N,N-dibenzyl-6-(1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 91963142 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N,N-dibenzyl-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H28N2O3/c31-26(29(20-22-12-4-1-5-13-22)21-23-14-6-2-7-15-23)18-8-3-11-19-30-27(32)24-16-9-10-17-25(24)28(30)33/h1-2,4-7,9-10,12-17H,3,8,11,18-21H2 |
| InChIKey | LEOHDNSDWNZMBY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|