C19H18N2O4 — CID 57370580
benzyl-[3-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid (PubChem CID 57370580) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is benzyl-[3-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid.
| Compound Name | benzyl-[3-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid |
|---|---|
| PubChem CID | 57370580 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | benzyl-[3-(1,3-dioxoisoindol-2-yl)propyl]carbamic acid |
| SMILES | O=C(O)N(CCCN1C(=O)c2ccccc2C1=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c22-17-15-9-4-5-10-16(15)18(23)21(17)12-6-11-20(19(24)25)13-14-7-2-1-3-8-14/h1-5,7-10H,6,11-13H2,(H,24,25) |
| InChIKey | BFVQPFTWDWVMQQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|