C15H18N2O4 — CID 82224048
3-[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]propanoic acid (PubChem CID 82224048) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]propanoic acid.
| Compound Name | 3-[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 82224048 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[3-(1,3-dioxoisoindol-2-yl)propyl-methylamino]propanoic acid |
| SMILES | CN(CCCN1C(=O)c2ccccc2C1=O)CCC(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-16(10-7-13(18)19)8-4-9-17-14(20)11-5-2-3-6-12(11)15(17)21/h2-3,5-6H,4,7-10H2,1H3,(H,18,19) |
| InChIKey | QTTLXWPVOPNPIV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|