C16H17NO5 — CID 19828637
8-(1,3-dioxoisoindol-2-yl)-3-oxooctanoic acid (PubChem CID 19828637) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 8-(1,3-dioxoisoindol-2-yl)-3-oxooctanoic acid.
| Compound Name | 8-(1,3-dioxoisoindol-2-yl)-3-oxooctanoic acid |
|---|---|
| PubChem CID | 19828637 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 8-(1,3-dioxoisoindol-2-yl)-3-oxooctanoic acid |
| SMILES | O=C(O)CC(=O)CCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H17NO5/c18-11(10-14(19)20)6-2-1-5-9-17-15(21)12-7-3-4-8-13(12)16(17)22/h3-4,7-8H,1-2,5-6,9-10H2,(H,19,20) |
| InChIKey | RPQHSWNYOMLAKM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|