C31H38Br2N2O4 — CID 19698937
2-(7-bromoheptyl)isoindole-1,3-dione;2-(8-bromooctyl)isoindole-1,3-dione (PubChem CID 19698937) has the molecular formula C31H38Br2N2O4 and a molecular weight of 662.46 g/mol. Its IUPAC name is 2-(7-bromoheptyl)isoindole-1,3-dione;2-(8-bromooctyl)isoindole-1,3-dione.
| Compound Name | 2-(7-bromoheptyl)isoindole-1,3-dione;2-(8-bromooctyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 19698937 |
| Molecular Formula | C31H38Br2N2O4 |
| Molecular Weight | 662.46 g/mol |
| Exact Mass | 660.12 |
| IUPAC Name | 2-(7-bromoheptyl)isoindole-1,3-dione;2-(8-bromooctyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCBr.O=C1c2ccccc2C(=O)N1CCCCCCCCBr |
| InChI | InChI=1S/C16H20BrNO2.C15H18BrNO2/c17-11-7-3-1-2-4-8-12-18-15(19)13-9-5-6-10-14(13)16(18)20;16-10-6-2-1-3-7-11-17-14(18)12-8-4-5-9-13(12)15(17)19/h5-6,9-10H,1-4,7-8,11-12H2;4-5,8-9H,1-3,6-7,10-11H2 |
| InChIKey | VVXHVHRXNWHIBX-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.46 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|