C13H15BrN2O2 — CID 19024285
4-(4-bromobutyl)-1,2-dihydro-1,4-benzodiazepine-3,5-dione (PubChem CID 19024285) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-(4-bromobutyl)-1,2-dihydro-1,4-benzodiazepine-3,5-dione.
| Compound Name | 4-(4-bromobutyl)-1,2-dihydro-1,4-benzodiazepine-3,5-dione |
|---|---|
| PubChem CID | 19024285 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-(4-bromobutyl)-1,2-dihydro-1,4-benzodiazepine-3,5-dione |
| SMILES | O=C1CNc2ccccc2C(=O)N1CCCCBr |
| InChI | InChI=1S/C13H15BrN2O2/c14-7-3-4-8-16-12(17)9-15-11-6-2-1-5-10(11)13(16)18/h1-2,5-6,15H,3-4,7-9H2 |
| InChIKey | VODPIHRSSWBXRB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|