C21H23BrN2O2 — CID 67760765
1-(5-bromopentyl)-3H-indol-2-one;1,3-dihydroindol-2-one (PubChem CID 67760765) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is 1-(5-bromopentyl)-3H-indol-2-one;1,3-dihydroindol-2-one.
| Compound Name | 1-(5-bromopentyl)-3H-indol-2-one;1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 67760765 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 1-(5-bromopentyl)-3H-indol-2-one;1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccccc2N1.O=C1Cc2ccccc2N1CCCCCBr |
| InChI | InChI=1S/C13H16BrNO.C8H7NO/c14-8-4-1-5-9-15-12-7-3-2-6-11(12)10-13(15)16;10-8-5-6-3-1-2-4-7(6)9-8/h2-3,6-7H,1,4-5,8-10H2;1-4H,5H2,(H,9,10) |
| InChIKey | KYQSQWPECOGKJB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|