C10H13NO — CID 54350510
1,3-dihydroindol-2-one;ethane (PubChem CID 54350510) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1,3-dihydroindol-2-one;ethane.
| Compound Name | 1,3-dihydroindol-2-one;ethane |
|---|---|
| PubChem CID | 54350510 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1,3-dihydroindol-2-one;ethane |
| SMILES | CC.O=C1Cc2ccccc2N1 |
| InChI | InChI=1S/C8H7NO.C2H6/c10-8-5-6-3-1-2-4-7(6)9-8;1-2/h1-4H,5H2,(H,9,10);1-2H3 |
| InChIKey | UFJUBKADWFDMSY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |