C11H15NO — CID 90913605
3,4-dihydro-1H-quinolin-2-one;ethane (PubChem CID 90913605) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 3,4-dihydro-1H-quinolin-2-one;ethane.
| Compound Name | 3,4-dihydro-1H-quinolin-2-one;ethane |
|---|---|
| PubChem CID | 90913605 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3,4-dihydro-1H-quinolin-2-one;ethane |
| SMILES | CC.O=C1CCc2ccccc2N1 |
| InChI | InChI=1S/C9H9NO.C2H6/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2/h1-4H,5-6H2,(H,10,11);1-2H3 |
| InChIKey | FPDRZDXPRUSYDX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |