C11H15NO — CID 143703020
methane;1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 143703020) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is methane;1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | methane;1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 143703020 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | methane;1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | C.O=C1CCCc2ccccc2N1 |
| InChI | InChI=1S/C10H11NO.CH4/c12-10-7-3-5-8-4-1-2-6-9(8)11-10;/h1-2,4,6H,3,5,7H2,(H,11,12);1H4 |
| InChIKey | WZJPBDXOOVCHQL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |