C17H16ClNO — CID 61086259
7-[chloro(phenyl)methyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 61086259) has the molecular formula C17H16ClNO and a molecular weight of 285.77 g/mol. Its IUPAC name is 7-[chloro(phenyl)methyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[chloro(phenyl)methyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 61086259 |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 7-[chloro(phenyl)methyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(C(Cl)c3ccccc3)ccc2N1 |
| InChI | InChI=1S/C17H16ClNO/c18-17(12-5-2-1-3-6-12)14-9-10-15-13(11-14)7-4-8-16(20)19-15/h1-3,5-6,9-11,17H,4,7-8H2,(H,19,20) |
| InChIKey | UVDGUMIWAVZAKS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|