C15H13BrClNOS — CID 107964552
7-[(5-bromothiophen-3-yl)-chloromethyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 107964552) has the molecular formula C15H13BrClNOS and a molecular weight of 370.70 g/mol. Its IUPAC name is 7-[(5-bromothiophen-3-yl)-chloromethyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[(5-bromothiophen-3-yl)-chloromethyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 107964552 |
| Molecular Formula | C15H13BrClNOS |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | 7-[(5-bromothiophen-3-yl)-chloromethyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(C(Cl)c3csc(Br)c3)ccc2N1 |
| InChI | InChI=1S/C15H13BrClNOS/c16-13-7-11(8-20-13)15(17)10-4-5-12-9(6-10)2-1-3-14(19)18-12/h4-8,15H,1-3H2,(H,18,19) |
| InChIKey | HHUIJPPROKBPRR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|