C14H18ClNO — CID 61086465
7-(1-chlorobutyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 61086465) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 7-(1-chlorobutyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-(1-chlorobutyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 61086465 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 7-(1-chlorobutyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | CCCC(Cl)c1ccc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C14H18ClNO/c1-2-4-12(15)10-7-8-13-11(9-10)5-3-6-14(17)16-13/h7-9,12H,2-6H2,1H3,(H,16,17) |
| InChIKey | MBSHORACOIQYLZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|