C14H15ClF3NO2 — CID 103210715
7-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 103210715) has the molecular formula C14H15ClF3NO2 and a molecular weight of 321.73 g/mol. Its IUPAC name is 7-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 103210715 |
| Molecular Formula | C14H15ClF3NO2 |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 7-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(C(Cl)COCC(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C14H15ClF3NO2/c15-11(7-21-8-14(16,17)18)9-4-5-12-10(6-9)2-1-3-13(20)19-12/h4-6,11H,1-3,7-8H2,(H,19,20) |
| InChIKey | LVTANEPUMMFZIW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|