C13H15F3N2O2 — CID 103207061
5-[1-amino-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydroindol-2-one (PubChem CID 103207061) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 5-[1-amino-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[1-amino-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 103207061 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 5-[1-amino-3-(2,2,2-trifluoroethoxy)propyl]-1,3-dihydroindol-2-one |
| SMILES | NC(CCOCC(F)(F)F)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H15F3N2O2/c14-13(15,16)7-20-4-3-10(17)8-1-2-11-9(5-8)6-12(19)18-11/h1-2,5,10H,3-4,6-7,17H2,(H,18,19) |
| InChIKey | GBZJXMNQAAATNO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|