C9H9BrN2O — CID 116947599
5-[amino(bromo)methyl]-1,3-dihydroindol-2-one (PubChem CID 116947599) has the molecular formula C9H9BrN2O and a molecular weight of 241.09 g/mol. Its IUPAC name is 5-[amino(bromo)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[amino(bromo)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 116947599 |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.09 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 5-[amino(bromo)methyl]-1,3-dihydroindol-2-one |
| SMILES | NC(Br)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C9H9BrN2O/c10-9(11)5-1-2-7-6(3-5)4-8(13)12-7/h1-3,9H,4,11H2,(H,12,13) |
| InChIKey | KAVJPSRHNNUXCB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.09 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|