C18H16BrNO — CID 61098131
5-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]-1,3-dihydroindol-2-one (PubChem CID 61098131) has the molecular formula C18H16BrNO and a molecular weight of 342.24 g/mol. Its IUPAC name is 5-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 61098131 |
| Molecular Formula | C18H16BrNO |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 5-[bromo(2,3-dihydro-1H-inden-5-yl)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(C(Br)c3ccc4c(c3)CCC4)ccc2N1 |
| InChI | InChI=1S/C18H16BrNO/c19-18(13-5-4-11-2-1-3-12(11)8-13)14-6-7-16-15(9-14)10-17(21)20-16/h4-9,18H,1-3,10H2,(H,20,21) |
| InChIKey | FHLYHANJEKVCPT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|