C17H15BrINO — CID 63442904
7-[bromo-(3-iodophenyl)methyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 63442904) has the molecular formula C17H15BrINO and a molecular weight of 456.12 g/mol. Its IUPAC name is 7-[bromo-(3-iodophenyl)methyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[bromo-(3-iodophenyl)methyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 63442904 |
| Molecular Formula | C17H15BrINO |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 454.94 |
| IUPAC Name | 7-[bromo-(3-iodophenyl)methyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(C(Br)c3cccc(I)c3)ccc2N1 |
| InChI | InChI=1S/C17H15BrINO/c18-17(12-4-1-5-14(19)10-12)13-7-8-15-11(9-13)3-2-6-16(21)20-15/h1,4-5,7-10,17H,2-3,6H2,(H,20,21) |
| InChIKey | ZQTBVPAMIDEENV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|