C16H14BrIO — CID 63444280
6-[bromo-(3-iodophenyl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 63444280) has the molecular formula C16H14BrIO and a molecular weight of 429.10 g/mol. Its IUPAC name is 6-[bromo-(3-iodophenyl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[bromo-(3-iodophenyl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 63444280 |
| Molecular Formula | C16H14BrIO |
| Molecular Weight | 429.10 g/mol |
| Exact Mass | 427.93 |
| IUPAC Name | 6-[bromo-(3-iodophenyl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | BrC(c1cccc(I)c1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C16H14BrIO/c17-16(12-3-1-5-14(18)10-12)13-6-7-15-11(9-13)4-2-8-19-15/h1,3,5-7,9-10,16H,2,4,8H2 |
| InChIKey | KBHXTKYCSWTSAD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.10 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|