C16H13BrOS2 — CID 80739025
6-[bromo(thieno[3,2-b]thiophen-5-yl)methyl]-3,4-dihydro-2H-chromene (PubChem CID 80739025) has the molecular formula C16H13BrOS2 and a molecular weight of 365.32 g/mol. Its IUPAC name is 6-[bromo(thieno[3,2-b]thiophen-5-yl)methyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[bromo(thieno[3,2-b]thiophen-5-yl)methyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 80739025 |
| Molecular Formula | C16H13BrOS2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 6-[bromo(thieno[3,2-b]thiophen-5-yl)methyl]-3,4-dihydro-2H-chromene |
| SMILES | BrC(c1ccc2c(c1)CCCO2)c1cc2sccc2s1 |
| InChI | InChI=1S/C16H13BrOS2/c17-16(15-9-14-13(20-15)5-7-19-14)11-3-4-12-10(8-11)2-1-6-18-12/h3-5,7-9,16H,1-2,6H2 |
| InChIKey | JDTKQIYAESLQLY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|