C16H13BrO2S2 — CID 80739008
7-[bromo(thieno[3,2-b]thiophen-5-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 80739008) has the molecular formula C16H13BrO2S2 and a molecular weight of 381.32 g/mol. Its IUPAC name is 7-[bromo(thieno[3,2-b]thiophen-5-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-[bromo(thieno[3,2-b]thiophen-5-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 80739008 |
| Molecular Formula | C16H13BrO2S2 |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 7-[bromo(thieno[3,2-b]thiophen-5-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | BrC(c1ccc2c(c1)OCCCO2)c1cc2sccc2s1 |
| InChI | InChI=1S/C16H13BrO2S2/c17-16(15-9-14-13(21-15)4-7-20-14)10-2-3-11-12(8-10)19-6-1-5-18-11/h2-4,7-9,16H,1,5-6H2 |
| InChIKey | WXOQMFZMCQWFKV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|