C15H10Cl2O2S2 — CID 80738912
6-chloro-7-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 80738912) has the molecular formula C15H10Cl2O2S2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 6-chloro-7-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-chloro-7-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 80738912 |
| Molecular Formula | C15H10Cl2O2S2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | 6-chloro-7-[chloro(thieno[3,2-b]thiophen-5-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Clc1cc2c(cc1C(Cl)c1cc3sccc3s1)OCCO2 |
| InChI | InChI=1S/C15H10Cl2O2S2/c16-9-6-11-10(18-2-3-19-11)5-8(9)15(17)14-7-13-12(21-14)1-4-20-13/h1,4-7,15H,2-3H2 |
| InChIKey | JRTOAVMBCFJAFF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|