C7H5ClOS2 — CID 123645090
chloro(thieno[3,2-b]thiophen-5-yl)methanol (PubChem CID 123645090) has the molecular formula C7H5ClOS2 and a molecular weight of 204.70 g/mol. Its IUPAC name is chloro(thieno[3,2-b]thiophen-5-yl)methanol.
| Compound Name | chloro(thieno[3,2-b]thiophen-5-yl)methanol |
|---|---|
| PubChem CID | 123645090 |
| Molecular Formula | C7H5ClOS2 |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 203.95 |
| IUPAC Name | chloro(thieno[3,2-b]thiophen-5-yl)methanol |
| SMILES | OC(Cl)c1cc2sccc2s1 |
| InChI | InChI=1S/C7H5ClOS2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3,7,9H |
| InChIKey | IEPZJJBZELNIBK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|