C13H8F2OS2 — CID 80745410
(2,4-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanol (PubChem CID 80745410) has the molecular formula C13H8F2OS2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2,4-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanol.
| Compound Name | (2,4-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanol |
|---|---|
| PubChem CID | 80745410 |
| Molecular Formula | C13H8F2OS2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | (2,4-difluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanol |
| SMILES | OC(c1cc2sccc2s1)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H8F2OS2/c14-7-1-2-8(9(15)5-7)13(16)12-6-11-10(18-12)3-4-17-11/h1-6,13,16H |
| InChIKey | KHCZEBWKONBIMN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |