C14H12OS2 — CID 114979263
(2-methylphenyl)-thieno[3,2-b]thiophen-5-ylmethanol (PubChem CID 114979263) has the molecular formula C14H12OS2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (2-methylphenyl)-thieno[3,2-b]thiophen-5-ylmethanol.
| Compound Name | (2-methylphenyl)-thieno[3,2-b]thiophen-5-ylmethanol |
|---|---|
| PubChem CID | 114979263 |
| Molecular Formula | C14H12OS2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | (2-methylphenyl)-thieno[3,2-b]thiophen-5-ylmethanol |
| SMILES | Cc1ccccc1C(O)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H12OS2/c1-9-4-2-3-5-10(9)14(15)13-8-12-11(17-13)6-7-16-12/h2-8,14-15H,1H3 |
| InChIKey | FPJHOZWPQZCTEN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |