C14H13NS2 — CID 115795113
(2-methylphenyl)-thieno[3,2-b]thiophen-5-ylmethanamine (PubChem CID 115795113) has the molecular formula C14H13NS2 and a molecular weight of 259.40 g/mol. Its IUPAC name is (2-methylphenyl)-thieno[3,2-b]thiophen-5-ylmethanamine.
| Compound Name | (2-methylphenyl)-thieno[3,2-b]thiophen-5-ylmethanamine |
|---|---|
| PubChem CID | 115795113 |
| Molecular Formula | C14H13NS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (2-methylphenyl)-thieno[3,2-b]thiophen-5-ylmethanamine |
| SMILES | Cc1ccccc1C(N)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H13NS2/c1-9-4-2-3-5-10(9)14(15)13-8-12-11(17-13)6-7-16-12/h2-8,14H,15H2,1H3 |
| InChIKey | QSIJOKOCGZIGBG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |