C13H8BrClFNS2 — CID 106764406
(4-bromo-3-chloro-2-fluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine (PubChem CID 106764406) has the molecular formula C13H8BrClFNS2 and a molecular weight of 376.70 g/mol. Its IUPAC name is (4-bromo-3-chloro-2-fluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine.
| Compound Name | (4-bromo-3-chloro-2-fluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine |
|---|---|
| PubChem CID | 106764406 |
| Molecular Formula | C13H8BrClFNS2 |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 374.90 |
| IUPAC Name | (4-bromo-3-chloro-2-fluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanamine |
| SMILES | NC(c1cc2sccc2s1)c1ccc(Br)c(Cl)c1F |
| InChI | InChI=1S/C13H8BrClFNS2/c14-7-2-1-6(12(16)11(7)15)13(17)10-5-9-8(19-10)3-4-18-9/h1-5,13H,17H2 |
| InChIKey | RCKIQFAAPQFQMO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|