C11H6BrClF3NS — CID 102828028
(4-bromo-5-chlorothiophen-2-yl)-(2,3,4-trifluorophenyl)methanamine (PubChem CID 102828028) has the molecular formula C11H6BrClF3NS and a molecular weight of 356.59 g/mol. Its IUPAC name is (4-bromo-5-chlorothiophen-2-yl)-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (4-bromo-5-chlorothiophen-2-yl)-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 102828028 |
| Molecular Formula | C11H6BrClF3NS |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 354.90 |
| IUPAC Name | (4-bromo-5-chlorothiophen-2-yl)-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1cc(Br)c(Cl)s1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H6BrClF3NS/c12-5-3-7(18-11(5)13)10(17)4-1-2-6(14)9(16)8(4)15/h1-3,10H,17H2 |
| InChIKey | IBYJRJBARQAKSM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|