C13H7ClF5N — CID 107475989
(2-chloro-4,5-difluorophenyl)-(2,3,4-trifluorophenyl)methanamine (PubChem CID 107475989) has the molecular formula C13H7ClF5N and a molecular weight of 307.65 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (2-chloro-4,5-difluorophenyl)-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 107475989 |
| Molecular Formula | C13H7ClF5N |
| Molecular Weight | 307.65 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1cc(F)c(F)cc1Cl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H7ClF5N/c14-7-4-10(17)9(16)3-6(7)13(20)5-1-2-8(15)12(19)11(5)18/h1-4,13H,20H2 |
| InChIKey | MBUWCFYIASNIBY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|