C11H6Cl2F3NS — CID 79749284
(2,5-dichlorothiophen-3-yl)-(2,3,4-trifluorophenyl)methanamine (PubChem CID 79749284) has the molecular formula C11H6Cl2F3NS and a molecular weight of 312.14 g/mol. Its IUPAC name is (2,5-dichlorothiophen-3-yl)-(2,3,4-trifluorophenyl)methanamine.
| Compound Name | (2,5-dichlorothiophen-3-yl)-(2,3,4-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 79749284 |
| Molecular Formula | C11H6Cl2F3NS |
| Molecular Weight | 312.14 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | (2,5-dichlorothiophen-3-yl)-(2,3,4-trifluorophenyl)methanamine |
| SMILES | NC(c1cc(Cl)sc1Cl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H6Cl2F3NS/c12-7-3-5(11(13)18-7)10(17)4-1-2-6(14)9(16)8(4)15/h1-3,10H,17H2 |
| InChIKey | IPHTYYBGJSLHNQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.14 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|