C13H9Cl3FN — CID 43344688
(2-chloro-4-fluorophenyl)-(2,5-dichlorophenyl)methanamine (PubChem CID 43344688) has the molecular formula C13H9Cl3FN and a molecular weight of 304.58 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-(2,5-dichlorophenyl)methanamine.
| Compound Name | (2-chloro-4-fluorophenyl)-(2,5-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 43344688 |
| Molecular Formula | C13H9Cl3FN |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-(2,5-dichlorophenyl)methanamine |
| SMILES | NC(c1ccc(F)cc1Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H9Cl3FN/c14-7-1-4-11(15)10(5-7)13(18)9-3-2-8(17)6-12(9)16/h1-6,13H,18H2 |
| InChIKey | XHRGDWSMMVBLSQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |