C17H12Cl3N — CID 79592111
(4-chloronaphthalen-1-yl)-(2,5-dichlorophenyl)methanamine (PubChem CID 79592111) has the molecular formula C17H12Cl3N and a molecular weight of 336.65 g/mol. Its IUPAC name is (4-chloronaphthalen-1-yl)-(2,5-dichlorophenyl)methanamine.
| Compound Name | (4-chloronaphthalen-1-yl)-(2,5-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 79592111 |
| Molecular Formula | C17H12Cl3N |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | (4-chloronaphthalen-1-yl)-(2,5-dichlorophenyl)methanamine |
| SMILES | NC(c1cc(Cl)ccc1Cl)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C17H12Cl3N/c18-10-5-7-16(20)14(9-10)17(21)13-6-8-15(19)12-4-2-1-3-11(12)13/h1-9,17H,21H2 |
| InChIKey | VBHSQSCIJWQAFD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |