C17H10Cl4 — CID 79592810
1-chloro-4-[chloro-(2,5-dichlorophenyl)methyl]naphthalene (PubChem CID 79592810) has the molecular formula C17H10Cl4 and a molecular weight of 356.08 g/mol. Its IUPAC name is 1-chloro-4-[chloro-(2,5-dichlorophenyl)methyl]naphthalene.
| Compound Name | 1-chloro-4-[chloro-(2,5-dichlorophenyl)methyl]naphthalene |
|---|---|
| PubChem CID | 79592810 |
| Molecular Formula | C17H10Cl4 |
| Molecular Weight | 356.08 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 1-chloro-4-[chloro-(2,5-dichlorophenyl)methyl]naphthalene |
| SMILES | Clc1ccc(Cl)c(C(Cl)c2ccc(Cl)c3ccccc23)c1 |
| InChI | InChI=1S/C17H10Cl4/c18-10-5-7-16(20)14(9-10)17(21)13-6-8-15(19)12-4-2-1-3-11(12)13/h1-9,17H |
| InChIKey | NCGFARZTTNGPLG-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.08 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|