C19H16Cl2 — CID 79592602
1-chloro-4-[chloro-(2,4-dimethylphenyl)methyl]naphthalene (PubChem CID 79592602) has the molecular formula C19H16Cl2 and a molecular weight of 315.24 g/mol. Its IUPAC name is 1-chloro-4-[chloro-(2,4-dimethylphenyl)methyl]naphthalene.
| Compound Name | 1-chloro-4-[chloro-(2,4-dimethylphenyl)methyl]naphthalene |
|---|---|
| PubChem CID | 79592602 |
| Molecular Formula | C19H16Cl2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-chloro-4-[chloro-(2,4-dimethylphenyl)methyl]naphthalene |
| SMILES | Cc1ccc(C(Cl)c2ccc(Cl)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C19H16Cl2/c1-12-7-8-14(13(2)11-12)19(21)17-9-10-18(20)16-6-4-3-5-15(16)17/h3-11,19H,1-2H3 |
| InChIKey | SLYIONSSPSUIDG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|