C12H7BrClF4NS — CID 102828128
(4-bromo-5-chlorothiophen-2-yl)-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine (PubChem CID 102828128) has the molecular formula C12H7BrClF4NS and a molecular weight of 388.61 g/mol. Its IUPAC name is (4-bromo-5-chlorothiophen-2-yl)-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (4-bromo-5-chlorothiophen-2-yl)-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 102828128 |
| Molecular Formula | C12H7BrClF4NS |
| Molecular Weight | 388.61 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | (4-bromo-5-chlorothiophen-2-yl)-[2-fluoro-5-(trifluoromethyl)phenyl]methanamine |
| SMILES | NC(c1cc(Br)c(Cl)s1)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C12H7BrClF4NS/c13-7-4-9(20-11(7)14)10(19)6-3-5(12(16,17)18)1-2-8(6)15/h1-4,10H,19H2 |
| InChIKey | ZVALTVQKZGNWHR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |