C7H5BrClF4NS — CID 102828109
1-(4-bromo-5-chlorothiophen-2-yl)-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 102828109) has the molecular formula C7H5BrClF4NS and a molecular weight of 326.54 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 102828109 |
| Molecular Formula | C7H5BrClF4NS |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 324.90 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | NC(c1cc(Br)c(Cl)s1)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H5BrClF4NS/c8-2-1-3(15-5(2)9)4(14)7(12,13)6(10)11/h1,4,6H,14H2 |
| InChIKey | UDVAQEPGCRIOHI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|