C7H5BrCl2F2S — CID 130605196
3-bromo-2-chloro-5-(1-chloro-2,2-difluoropropyl)thiophene (PubChem CID 130605196) has the molecular formula C7H5BrCl2F2S and a molecular weight of 309.99 g/mol. Its IUPAC name is 3-bromo-2-chloro-5-(1-chloro-2,2-difluoropropyl)thiophene.
| Compound Name | 3-bromo-2-chloro-5-(1-chloro-2,2-difluoropropyl)thiophene |
|---|---|
| PubChem CID | 130605196 |
| Molecular Formula | C7H5BrCl2F2S |
| Molecular Weight | 309.99 g/mol |
| Exact Mass | 307.86 |
| IUPAC Name | 3-bromo-2-chloro-5-(1-chloro-2,2-difluoropropyl)thiophene |
| SMILES | CC(F)(F)C(Cl)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C7H5BrCl2F2S/c1-7(11,12)5(9)4-2-3(8)6(10)13-4/h2,5H,1H3 |
| InChIKey | GNNHAEZWVJEZHM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.99 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|