C9H3BrCl4S2 — CID 107965054
3-bromo-2-chloro-5-[chloro-(2,5-dichlorothiophen-3-yl)methyl]thiophene (PubChem CID 107965054) has the molecular formula C9H3BrCl4S2 and a molecular weight of 396.97 g/mol. Its IUPAC name is 3-bromo-2-chloro-5-[chloro-(2,5-dichlorothiophen-3-yl)methyl]thiophene.
| Compound Name | 3-bromo-2-chloro-5-[chloro-(2,5-dichlorothiophen-3-yl)methyl]thiophene |
|---|---|
| PubChem CID | 107965054 |
| Molecular Formula | C9H3BrCl4S2 |
| Molecular Weight | 396.97 g/mol |
| Exact Mass | 393.76 |
| IUPAC Name | 3-bromo-2-chloro-5-[chloro-(2,5-dichlorothiophen-3-yl)methyl]thiophene |
| SMILES | Clc1cc(C(Cl)c2cc(Br)c(Cl)s2)c(Cl)s1 |
| InChI | InChI=1S/C9H3BrCl4S2/c10-4-2-5(15-9(4)14)7(12)3-1-6(11)16-8(3)13/h1-2,7H |
| InChIKey | IXBVFHJWTFIUSW-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.97 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|