C11H4Cl3F3S — CID 114021706
2,5-dichloro-3-[chloro-(2,4,5-trifluorophenyl)methyl]thiophene (PubChem CID 114021706) has the molecular formula C11H4Cl3F3S and a molecular weight of 331.57 g/mol. Its IUPAC name is 2,5-dichloro-3-[chloro-(2,4,5-trifluorophenyl)methyl]thiophene.
| Compound Name | 2,5-dichloro-3-[chloro-(2,4,5-trifluorophenyl)methyl]thiophene |
|---|---|
| PubChem CID | 114021706 |
| Molecular Formula | C11H4Cl3F3S |
| Molecular Weight | 331.57 g/mol |
| Exact Mass | 329.91 |
| IUPAC Name | 2,5-dichloro-3-[chloro-(2,4,5-trifluorophenyl)methyl]thiophene |
| SMILES | Fc1cc(F)c(C(Cl)c2cc(Cl)sc2Cl)cc1F |
| InChI | InChI=1S/C11H4Cl3F3S/c12-9-2-5(11(14)18-9)10(13)4-1-7(16)8(17)3-6(4)15/h1-3,10H |
| InChIKey | QSGUPNGFDQIAHH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|