C13H6Cl3F3 — CID 103304052
1-[chloro-(3,5-dichlorophenyl)methyl]-2,4,5-trifluorobenzene (PubChem CID 103304052) has the molecular formula C13H6Cl3F3 and a molecular weight of 325.54 g/mol. Its IUPAC name is 1-[chloro-(3,5-dichlorophenyl)methyl]-2,4,5-trifluorobenzene.
| Compound Name | 1-[chloro-(3,5-dichlorophenyl)methyl]-2,4,5-trifluorobenzene |
|---|---|
| PubChem CID | 103304052 |
| Molecular Formula | C13H6Cl3F3 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | 1-[chloro-(3,5-dichlorophenyl)methyl]-2,4,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Cl)c2cc(Cl)cc(Cl)c2)cc1F |
| InChI | InChI=1S/C13H6Cl3F3/c14-7-1-6(2-8(15)3-7)13(16)9-4-11(18)12(19)5-10(9)17/h1-5,13H |
| InChIKey | MTZPNRKREOKAJG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|