C16H12ClF3 — CID 103303651
5-[chloro-(2,4,5-trifluorophenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 103303651) has the molecular formula C16H12ClF3 and a molecular weight of 296.72 g/mol. Its IUPAC name is 5-[chloro-(2,4,5-trifluorophenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[chloro-(2,4,5-trifluorophenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 103303651 |
| Molecular Formula | C16H12ClF3 |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-[chloro-(2,4,5-trifluorophenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | Fc1cc(F)c(C(Cl)c2ccc3c(c2)CCC3)cc1F |
| InChI | InChI=1S/C16H12ClF3/c17-16(12-7-14(19)15(20)8-13(12)18)11-5-4-9-2-1-3-10(9)6-11/h4-8,16H,1-3H2 |
| InChIKey | PYGKKLITVKENSE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|