C18H18Cl2O — CID 63430805
6-[chloro-(4-chloro-2-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 63430805) has the molecular formula C18H18Cl2O and a molecular weight of 321.25 g/mol. Its IUPAC name is 6-[chloro-(4-chloro-2-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[chloro-(4-chloro-2-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 63430805 |
| Molecular Formula | C18H18Cl2O |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 6-[chloro-(4-chloro-2-methoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cc(Cl)ccc1C(Cl)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H18Cl2O/c1-21-17-11-15(19)8-9-16(17)18(20)14-7-6-12-4-2-3-5-13(12)10-14/h6-11,18H,2-5H2,1H3 |
| InChIKey | OWNGFLLNOMNPAM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|