C16H13Cl2F — CID 63432035
5-[chloro-(4-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 63432035) has the molecular formula C16H13Cl2F and a molecular weight of 295.18 g/mol. Its IUPAC name is 5-[chloro-(4-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 5-[chloro-(4-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 63432035 |
| Molecular Formula | C16H13Cl2F |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-[chloro-(4-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | Fc1cc(Cl)ccc1C(Cl)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H13Cl2F/c17-13-6-7-14(15(19)9-13)16(18)12-5-4-10-2-1-3-11(10)8-12/h4-9,16H,1-3H2 |
| InChIKey | FHUMAQVTNNDNLI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|